C15H17F4NO2 — CID 120509624
4-[[2-fluoro-5-(trifluoromethyl)phenyl]methylamino]cyclohexane-1-carboxylic acid (PubChem CID 120509624) has the molecular formula C15H17F4NO2 and a molecular weight of 319.30 g/mol. Its IUPAC name is 4-[[2-fluoro-5-(trifluoromethyl)phenyl]methylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[2-fluoro-5-(trifluoromethyl)phenyl]methylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120509624 |
| Molecular Formula | C15H17F4NO2 |
| Molecular Weight | 319.30 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | 4-[[2-fluoro-5-(trifluoromethyl)phenyl]methylamino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(NCc2cc(C(F)(F)F)ccc2F)CC1 |
| InChI | InChI=1S/C15H17F4NO2/c16-13-6-3-11(15(17,18)19)7-10(13)8-20-12-4-1-9(2-5-12)14(21)22/h3,6-7,9,12,20H,1-2,4-5,8H2,(H,21,22) |
| InChIKey | PMZLKJXYQLIHEM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.30 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |