C14H17ClFNO2 — CID 81155541
4-[(3-chloro-4-fluorophenyl)methylamino]cyclohexane-1-carboxylic acid (PubChem CID 81155541) has the molecular formula C14H17ClFNO2 and a molecular weight of 285.75 g/mol. Its IUPAC name is 4-[(3-chloro-4-fluorophenyl)methylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(3-chloro-4-fluorophenyl)methylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 81155541 |
| Molecular Formula | C14H17ClFNO2 |
| Molecular Weight | 285.75 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | 4-[(3-chloro-4-fluorophenyl)methylamino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(NCc2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C14H17ClFNO2/c15-12-7-9(1-6-13(12)16)8-17-11-4-2-10(3-5-11)14(18)19/h1,6-7,10-11,17H,2-5,8H2,(H,18,19) |
| InChIKey | HNGJIQSOSUFBBY-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.75 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |