C14H18INO2 — CID 65478258
4-[(4-iodophenyl)methylamino]cyclohexane-1-carboxylic acid (PubChem CID 65478258) has the molecular formula C14H18INO2 and a molecular weight of 359.21 g/mol. Its IUPAC name is 4-[(4-iodophenyl)methylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(4-iodophenyl)methylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 65478258 |
| Molecular Formula | C14H18INO2 |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | 4-[(4-iodophenyl)methylamino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(NCc2ccc(I)cc2)CC1 |
| InChI | InChI=1S/C14H18INO2/c15-12-5-1-10(2-6-12)9-16-13-7-3-11(4-8-13)14(17)18/h1-2,5-6,11,13,16H,3-4,7-9H2,(H,17,18) |
| InChIKey | ZJAPFQCVTFUWFH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|