C16H21FN2O2 — CID 84753304
1-[5-[(cyclopropylamino)methyl]-2-fluorophenyl]piperidine-4-carboxylic acid (PubChem CID 84753304) has the molecular formula C16H21FN2O2 and a molecular weight of 292.35 g/mol. Its IUPAC name is 1-[5-[(cyclopropylamino)methyl]-2-fluorophenyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[5-[(cyclopropylamino)methyl]-2-fluorophenyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 84753304 |
| Molecular Formula | C16H21FN2O2 |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 1-[5-[(cyclopropylamino)methyl]-2-fluorophenyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(c2cc(CNC3CC3)ccc2F)CC1 |
| InChI | InChI=1S/C16H21FN2O2/c17-14-4-1-11(10-18-13-2-3-13)9-15(14)19-7-5-12(6-8-19)16(20)21/h1,4,9,12-13,18H,2-3,5-8,10H2,(H,20,21) |
| InChIKey | XRRQSCGXTYJDMI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |