C17H23NO2 — CID 79977776
4-[(4-cyclopropylphenyl)methylamino]cyclohexane-1-carboxylic acid (PubChem CID 79977776) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 4-[(4-cyclopropylphenyl)methylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(4-cyclopropylphenyl)methylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 79977776 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 4-[(4-cyclopropylphenyl)methylamino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(NCc2ccc(C3CC3)cc2)CC1 |
| InChI | InChI=1S/C17H23NO2/c19-17(20)15-7-9-16(10-8-15)18-11-12-1-3-13(4-2-12)14-5-6-14/h1-4,14-16,18H,5-11H2,(H,19,20) |
| InChIKey | GGUVHDDNJAFZAB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |