C10H13BFNO2 — CID 56776658
[4-[(cyclopropylamino)methyl]-2-fluorophenyl]boronic acid (PubChem CID 56776658) has the molecular formula C10H13BFNO2 and a molecular weight of 209.03 g/mol. Its IUPAC name is [4-[(cyclopropylamino)methyl]-2-fluorophenyl]boronic acid.
| Compound Name | [4-[(cyclopropylamino)methyl]-2-fluorophenyl]boronic acid |
|---|---|
| PubChem CID | 56776658 |
| Molecular Formula | C10H13BFNO2 |
| Molecular Weight | 209.03 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | [4-[(cyclopropylamino)methyl]-2-fluorophenyl]boronic acid |
| SMILES | OB(O)c1ccc(CNC2CC2)cc1F |
| InChI | InChI=1S/C10H13BFNO2/c12-10-5-7(6-13-8-2-3-8)1-4-9(10)11(14)15/h1,4-5,8,13-15H,2-3,6H2 |
| InChIKey | KJXGWKJDSBWTSC-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.03 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|