C15H17BrF3NO2 — CID 120509886
4-[[3-bromo-5-(trifluoromethyl)phenyl]methylamino]cyclohexane-1-carboxylic acid (PubChem CID 120509886) has the molecular formula C15H17BrF3NO2 and a molecular weight of 380.20 g/mol. Its IUPAC name is 4-[[3-bromo-5-(trifluoromethyl)phenyl]methylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[3-bromo-5-(trifluoromethyl)phenyl]methylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 120509886 |
| Molecular Formula | C15H17BrF3NO2 |
| Molecular Weight | 380.20 g/mol |
| Exact Mass | 379.04 |
| IUPAC Name | 4-[[3-bromo-5-(trifluoromethyl)phenyl]methylamino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(NCc2cc(Br)cc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C15H17BrF3NO2/c16-12-6-9(5-11(7-12)15(17,18)19)8-20-13-3-1-10(2-4-13)14(21)22/h5-7,10,13,20H,1-4,8H2,(H,21,22) |
| InChIKey | NVYCXEAJEOQKIK-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.20 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |