C17H22F3NO2 — CID 122030753
4-[3-[3-(trifluoromethyl)phenyl]propylamino]cyclohexane-1-carboxylic acid (PubChem CID 122030753) has the molecular formula C17H22F3NO2 and a molecular weight of 329.36 g/mol. Its IUPAC name is 4-[3-[3-(trifluoromethyl)phenyl]propylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[3-[3-(trifluoromethyl)phenyl]propylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122030753 |
| Molecular Formula | C17H22F3NO2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | 4-[3-[3-(trifluoromethyl)phenyl]propylamino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(NCCCc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C17H22F3NO2/c18-17(19,20)14-5-1-3-12(11-14)4-2-10-21-15-8-6-13(7-9-15)16(22)23/h1,3,5,11,13,15,21H,2,4,6-10H2,(H,22,23) |
| InChIKey | NSXYQNACOSWGON-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|