C14H15F3O2 — CID 142067095
2-methylidene-6-[3-(trifluoromethyl)phenyl]hexanoic acid (PubChem CID 142067095) has the molecular formula C14H15F3O2 and a molecular weight of 272.27 g/mol. Its IUPAC name is 2-methylidene-6-[3-(trifluoromethyl)phenyl]hexanoic acid.
| Compound Name | 2-methylidene-6-[3-(trifluoromethyl)phenyl]hexanoic acid |
|---|---|
| PubChem CID | 142067095 |
| Molecular Formula | C14H15F3O2 |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 2-methylidene-6-[3-(trifluoromethyl)phenyl]hexanoic acid |
| SMILES | C=C(CCCCc1cccc(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C14H15F3O2/c1-10(13(18)19)5-2-3-6-11-7-4-8-12(9-11)14(15,16)17/h4,7-9H,1-3,5-6H2,(H,18,19) |
| InChIKey | IRWGCUJIWZFSQN-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|