C16H22F3NO2 — CID 122124293
(2R)-3-methyl-2-[4-[3-(trifluoromethyl)phenyl]butylamino]butanoic acid (PubChem CID 122124293) has the molecular formula C16H22F3NO2 and a molecular weight of 317.35 g/mol. Its IUPAC name is (2R)-3-methyl-2-[4-[3-(trifluoromethyl)phenyl]butylamino]butanoic acid.
| Compound Name | (2R)-3-methyl-2-[4-[3-(trifluoromethyl)phenyl]butylamino]butanoic acid |
|---|---|
| PubChem CID | 122124293 |
| Molecular Formula | C16H22F3NO2 |
| Molecular Weight | 317.35 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | (2R)-3-methyl-2-[4-[3-(trifluoromethyl)phenyl]butylamino]butanoic acid |
| SMILES | CC(C)[C@@H](NCCCCc1cccc(C(F)(F)F)c1)C(=O)O |
| InChI | InChI=1S/C16H22F3NO2/c1-11(2)14(15(21)22)20-9-4-3-6-12-7-5-8-13(10-12)16(17,18)19/h5,7-8,10-11,14,20H,3-4,6,9H2,1-2H3,(H,21,22)/t14-/m1/s1 |
| InChIKey | NHSIHJBCZZODCC-CQSZACIVSA-N |
| XLogP | 3.73 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.35 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|