C17H18F3NO3 — CID 99124828
(2R)-3-methyl-2-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylamino]butanoic acid (PubChem CID 99124828) has the molecular formula C17H18F3NO3 and a molecular weight of 341.33 g/mol. Its IUPAC name is (2R)-3-methyl-2-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylamino]butanoic acid.
| Compound Name | (2R)-3-methyl-2-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylamino]butanoic acid |
|---|---|
| PubChem CID | 99124828 |
| Molecular Formula | C17H18F3NO3 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | (2R)-3-methyl-2-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methylamino]butanoic acid |
| SMILES | CC(C)[C@@H](NCc1ccc(-c2cccc(C(F)(F)F)c2)o1)C(=O)O |
| InChI | InChI=1S/C17H18F3NO3/c1-10(2)15(16(22)23)21-9-13-6-7-14(24-13)11-4-3-5-12(8-11)17(18,19)20/h3-8,10,15,21H,9H2,1-2H3,(H,22,23)/t15-/m1/s1 |
| InChIKey | AOJZIRGOQLSCON-OAHLLOKOSA-N |
| XLogP | 4.16 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |