C19H13F3O3 — CID 66939291
4-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methyl]benzoic acid (PubChem CID 66939291) has the molecular formula C19H13F3O3 and a molecular weight of 346.30 g/mol. Its IUPAC name is 4-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methyl]benzoic acid.
| Compound Name | 4-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 66939291 |
| Molecular Formula | C19H13F3O3 |
| Molecular Weight | 346.30 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | 4-[[5-[3-(trifluoromethyl)phenyl]furan-2-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(Cc2ccc(-c3cccc(C(F)(F)F)c3)o2)cc1 |
| InChI | InChI=1S/C19H13F3O3/c20-19(21,22)15-3-1-2-14(11-15)17-9-8-16(25-17)10-12-4-6-13(7-5-12)18(23)24/h1-9,11H,10H2,(H,23,24) |
| InChIKey | BWFWYLUCELLFNT-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.30 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |