C13H6F6O3 — CID 960607
5-[3,5-bis(trifluoromethyl)phenyl]furan-2-carboxylic acid (PubChem CID 960607) has the molecular formula C13H6F6O3 and a molecular weight of 324.18 g/mol. Its IUPAC name is 5-[3,5-bis(trifluoromethyl)phenyl]furan-2-carboxylic acid.
| Compound Name | 5-[3,5-bis(trifluoromethyl)phenyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 960607 |
| Molecular Formula | C13H6F6O3 |
| Molecular Weight | 324.18 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | 5-[3,5-bis(trifluoromethyl)phenyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(-c2cc(C(F)(F)F)cc(C(F)(F)F)c2)o1 |
| InChI | InChI=1S/C13H6F6O3/c14-12(15,16)7-3-6(4-8(5-7)13(17,18)19)9-1-2-10(22-9)11(20)21/h1-5H,(H,20,21) |
| InChIKey | UUEDYKYUEHYLDJ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.18 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |