C12H8O6 — CID 57339526
5-(3-carboxy-4-hydroxyphenyl)furan-2-carboxylic acid (PubChem CID 57339526) has the molecular formula C12H8O6 and a molecular weight of 248.19 g/mol. Its IUPAC name is 5-(3-carboxy-4-hydroxyphenyl)furan-2-carboxylic acid.
| Compound Name | 5-(3-carboxy-4-hydroxyphenyl)furan-2-carboxylic acid |
|---|---|
| PubChem CID | 57339526 |
| Molecular Formula | C12H8O6 |
| Molecular Weight | 248.19 g/mol |
| Exact Mass | 248.03 |
| IUPAC Name | 5-(3-carboxy-4-hydroxyphenyl)furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(-c2ccc(O)c(C(=O)O)c2)o1 |
| InChI | InChI=1S/C12H8O6/c13-8-2-1-6(5-7(8)11(14)15)9-3-4-10(18-9)12(16)17/h1-5,13H,(H,14,15)(H,16,17) |
| InChIKey | IMCGUYIXYODOKI-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.19 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |