C17H14O5 — CID 168893652
2-hydroxy-5-[5-[(E)-(2-oxocyclopentylidene)methyl]furan-2-yl]benzoic acid (PubChem CID 168893652) has the molecular formula C17H14O5 and a molecular weight of 298.29 g/mol. Its IUPAC name is 2-hydroxy-5-[5-[(E)-(2-oxocyclopentylidene)methyl]furan-2-yl]benzoic acid.
| Compound Name | 2-hydroxy-5-[5-[(E)-(2-oxocyclopentylidene)methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 168893652 |
| Molecular Formula | C17H14O5 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 2-hydroxy-5-[5-[(E)-(2-oxocyclopentylidene)methyl]furan-2-yl]benzoic acid |
| SMILES | O=C1CCC/C1=C\c1ccc(-c2ccc(O)c(C(=O)O)c2)o1 |
| InChI | InChI=1S/C17H14O5/c18-14-3-1-2-10(14)8-12-5-7-16(22-12)11-4-6-15(19)13(9-11)17(20)21/h4-9,19H,1-3H2,(H,20,21)/b10-8+ |
| InChIKey | ARYQMLPOCZKWJE-CSKARUKUSA-N |
| XLogP | 3.49 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|