C28H18Cl4O3 — CID 4616716
2,6-bis[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]cyclohexan-1-one (PubChem CID 4616716) has the molecular formula C28H18Cl4O3 and a molecular weight of 544.26 g/mol. Its IUPAC name is 2,6-bis[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]cyclohexan-1-one.
| Compound Name | 2,6-bis[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 4616716 |
| Molecular Formula | C28H18Cl4O3 |
| Molecular Weight | 544.26 g/mol |
| Exact Mass | 542.00 |
| IUPAC Name | 2,6-bis[[5-(3,4-dichlorophenyl)furan-2-yl]methylidene]cyclohexan-1-one |
| SMILES | O=C1C(=Cc2ccc(-c3ccc(Cl)c(Cl)c3)o2)CCCC1=Cc1ccc(-c2ccc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C28H18Cl4O3/c29-22-8-4-16(14-24(22)31)26-10-6-20(34-26)12-18-2-1-3-19(28(18)33)13-21-7-11-27(35-21)17-5-9-23(30)25(32)15-17/h4-15H,1-3H2 |
| InChIKey | ZXWJBKIYJFFFLH-UHFFFAOYSA-N |
| XLogP | 10.04 |
| TPSA | 43.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.26 |
| LogP ≤ 5 | 10.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|