C17H14O4 — CID 168893570
3-[5-[(E)-(2-oxocyclopentylidene)methyl]furan-2-yl]benzoic acid (PubChem CID 168893570) has the molecular formula C17H14O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is 3-[5-[(E)-(2-oxocyclopentylidene)methyl]furan-2-yl]benzoic acid.
| Compound Name | 3-[5-[(E)-(2-oxocyclopentylidene)methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 168893570 |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 3-[5-[(E)-(2-oxocyclopentylidene)methyl]furan-2-yl]benzoic acid |
| SMILES | O=C1CCC/C1=C\c1ccc(-c2cccc(C(=O)O)c2)o1 |
| InChI | InChI=1S/C17H14O4/c18-15-6-2-3-11(15)10-14-7-8-16(21-14)12-4-1-5-13(9-12)17(19)20/h1,4-5,7-10H,2-3,6H2,(H,19,20)/b11-10+ |
| InChIKey | AJBUSRWVQKMFCV-ZHACJKMWSA-N |
| XLogP | 3.78 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|