C19H12INO4 — CID 143921828
3-[5-[(E)-(8-oxo-3λ3-ioda-9-azabicyclo[4.3.0]nona-1,3,5-trien-7-ylidene)methyl]furan-2-yl]benzoic acid (PubChem CID 143921828) has the molecular formula C19H12INO4 and a molecular weight of 445.21 g/mol. Its IUPAC name is 3-[5-[(E)-(8-oxo-3λ3-ioda-9-azabicyclo[4.3.0]nona-1,3,5-trien-7-ylidene)methyl]furan-2-yl]benzoic acid.
| Compound Name | 3-[5-[(E)-(8-oxo-3λ3-ioda-9-azabicyclo[4.3.0]nona-1,3,5-trien-7-ylidene)methyl]furan-2-yl]benzoic acid |
|---|---|
| PubChem CID | 143921828 |
| Molecular Formula | C19H12INO4 |
| Molecular Weight | 445.21 g/mol |
| Exact Mass | 444.98 |
| IUPAC Name | 3-[5-[(E)-(8-oxo-3λ3-ioda-9-azabicyclo[4.3.0]nona-1,3,5-trien-7-ylidene)methyl]furan-2-yl]benzoic acid |
| SMILES | O=C1NC2=CI=CC=C2/C1=C\c1ccc(-c2cccc(C(=O)O)c2)o1 |
| InChI | InChI=1S/C19H12INO4/c22-18-15(14-6-7-20-10-16(14)21-18)9-13-4-5-17(25-13)11-2-1-3-12(8-11)19(23)24/h1-10H,(H,21,22)(H,23,24)/b15-9+ |
| InChIKey | UHQAILWKZDOSPP-OQLLNIDSSA-N |
| XLogP | 3.71 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.21 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|