C18H10N2O4S — CID 73389363
5-[[5-(3-prop-2-ynoylphenyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione (PubChem CID 73389363) has the molecular formula C18H10N2O4S and a molecular weight of 350.36 g/mol. Its IUPAC name is 5-[[5-(3-prop-2-ynoylphenyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione.
| Compound Name | 5-[[5-(3-prop-2-ynoylphenyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
|---|---|
| PubChem CID | 73389363 |
| Molecular Formula | C18H10N2O4S |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | 5-[[5-(3-prop-2-ynoylphenyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-diazinane-4,6-dione |
| SMILES | C#CC(=O)c1cccc(-c2ccc(C=C3C(=O)NC(=S)NC3=O)o2)c1 |
| InChI | InChI=1S/C18H10N2O4S/c1-2-14(21)10-4-3-5-11(8-10)15-7-6-12(24-15)9-13-16(22)19-18(25)20-17(13)23/h1,3-9H,(H2,19,20,22,23,25) |
| InChIKey | DUXSMWLNVXKWEA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|