C22H20N2O6 — CID 50887798
cyclohexyl 3-[5-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]furan-2-yl]benzoate (PubChem CID 50887798) has the molecular formula C22H20N2O6 and a molecular weight of 408.41 g/mol. Its IUPAC name is cyclohexyl 3-[5-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]furan-2-yl]benzoate.
| Compound Name | cyclohexyl 3-[5-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 50887798 |
| Molecular Formula | C22H20N2O6 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | cyclohexyl 3-[5-[(2,4,6-trioxo-1,3-diazinan-5-ylidene)methyl]furan-2-yl]benzoate |
| SMILES | O=C1NC(=O)C(=Cc2ccc(-c3cccc(C(=O)OC4CCCCC4)c3)o2)C(=O)N1 |
| InChI | InChI=1S/C22H20N2O6/c25-19-17(20(26)24-22(28)23-19)12-16-9-10-18(29-16)13-5-4-6-14(11-13)21(27)30-15-7-2-1-3-8-15/h4-6,9-12,15H,1-3,7-8H2,(H2,23,24,25,26,28) |
| InChIKey | GKTZEFNJSIJPEG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|