C25H21ClN2O4 — CID 72539134
5-chloro-3-[[5-[3-(3-hydroxypiperidine-1-carbonyl)phenyl]furan-2-yl]methylidene]-1H-indol-2-one (PubChem CID 72539134) has the molecular formula C25H21ClN2O4 and a molecular weight of 448.91 g/mol. Its IUPAC name is 5-chloro-3-[[5-[3-(3-hydroxypiperidine-1-carbonyl)phenyl]furan-2-yl]methylidene]-1H-indol-2-one.
| Compound Name | 5-chloro-3-[[5-[3-(3-hydroxypiperidine-1-carbonyl)phenyl]furan-2-yl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 72539134 |
| Molecular Formula | C25H21ClN2O4 |
| Molecular Weight | 448.91 g/mol |
| Exact Mass | 448.12 |
| IUPAC Name | 5-chloro-3-[[5-[3-(3-hydroxypiperidine-1-carbonyl)phenyl]furan-2-yl]methylidene]-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(Cl)cc2C1=Cc1ccc(-c2cccc(C(=O)N3CCCC(O)C3)c2)o1 |
| InChI | InChI=1S/C25H21ClN2O4/c26-17-6-8-22-20(12-17)21(24(30)27-22)13-19-7-9-23(32-19)15-3-1-4-16(11-15)25(31)28-10-2-5-18(29)14-28/h1,3-4,6-9,11-13,18,29H,2,5,10,14H2,(H,27,30) |
| InChIKey | VCWZQXMZZXQMFF-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.91 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|