C20H13ClNO3S- — CID 91395349
CID 91395349 (PubChem CID 91395349) has the molecular formula C20H13ClNO3S- and a molecular weight of 382.85 g/mol.
| Compound Name | CID 91395349 |
|---|---|
| PubChem CID | 91395349 |
| Molecular Formula | C20H13ClNO3S- |
| Molecular Weight | 382.85 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | — |
| SMILES | C=[S-](=O)c1ccc(-c2ccc(C=C3C(=O)Nc4ccc(Cl)cc43)o2)cc1 |
| InChI | InChI=1S/C20H13ClNO3S/c1-26(24)15-6-2-12(3-7-15)19-9-5-14(25-19)11-17-16-10-13(21)4-8-18(16)22-20(17)23/h2-11H,1H2,(H,22,23)/q-1 |
| InChIKey | BKKRQHSWZYOPBN-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.85 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|