About CID 91395349
CID 91395349 (PubChem CID 91395349) has the molecular formula C20H13ClNO3S-
and a molecular weight of 382.85 g/mol.
Molecular Properties
| Compound Name | CID 91395349 |
| PubChem CID | 91395349 |
| Molecular Formula | C20H13ClNO3S- |
| Molecular Weight | 382.85 g/mol |
| Exact Mass | 382.03 |
| IUPAC Name | — |
| SMILES | C=[S-](=O)c1ccc(-c2ccc(C=C3C(=O)Nc4ccc(Cl)cc43)o2)cc1 |
| InChI | InChI=1S/C20H13ClNO3S/c1-26(24)15-6-2-12(3-7-15)19-9-5-14(25-19)11-17-16-10-13(21)4-8-18(16)22-20(17)23/h2-11H,1H2,(H,22,23)/q-1 |
| InChIKey | BKKRQHSWZYOPBN-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.85 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze CID 91395349 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 91395349?
The IUPAC name of CID 91395349 (CID 91395349) is not available.
What is the SMILES notation for CID 91395349?
The canonical SMILES for CID 91395349 is C=[S-](=O)c1ccc(-c2ccc(C=C3C(=O)Nc4ccc(Cl)cc43)o2)cc1.
What is the InChIKey of CID 91395349?
The InChIKey is BKKRQHSWZYOPBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13ClNO3S/c1-26(24)15-6-2-12(3-7-15)19-9-5-14(25-19)11-17-16-10-13(21)4-8-18(16)22-20(17)23/h2-11H,1H2,(H,22,23)/q-1.
What are the key properties of CID 91395349?
CID 91395349 has a molecular weight of 382.85 g/mol, XLogP of 4.85, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 91395349 is sourced from PubChem (CID 91395349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).