C15H8Cl3NO — CID 2449460
(3Z)-5-chloro-3-[(2,6-dichlorophenyl)methylidene]-1H-indol-2-one (PubChem CID 2449460) has the molecular formula C15H8Cl3NO and a molecular weight of 324.59 g/mol. Its IUPAC name is (3Z)-5-chloro-3-[(2,6-dichlorophenyl)methylidene]-1H-indol-2-one.
| Compound Name | (3Z)-5-chloro-3-[(2,6-dichlorophenyl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 2449460 |
| Molecular Formula | C15H8Cl3NO |
| Molecular Weight | 324.59 g/mol |
| Exact Mass | 322.97 |
| IUPAC Name | (3Z)-5-chloro-3-[(2,6-dichlorophenyl)methylidene]-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(Cl)cc2/C1=C/c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C15H8Cl3NO/c16-8-4-5-14-9(6-8)10(15(20)19-14)7-11-12(17)2-1-3-13(11)18/h1-7H,(H,19,20)/b10-7- |
| InChIKey | MIVXAWPQWYPHCZ-YFHOEESVSA-N |
| XLogP | 5.14 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.59 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|