C21H16ClNO2 — CID 7947115
(3E)-5-chloro-3-[(2-ethoxynaphthalen-1-yl)methylidene]-1H-indol-2-one (PubChem CID 7947115) has the molecular formula C21H16ClNO2 and a molecular weight of 349.82 g/mol. Its IUPAC name is (3E)-5-chloro-3-[(2-ethoxynaphthalen-1-yl)methylidene]-1H-indol-2-one.
| Compound Name | (3E)-5-chloro-3-[(2-ethoxynaphthalen-1-yl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 7947115 |
| Molecular Formula | C21H16ClNO2 |
| Molecular Weight | 349.82 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | (3E)-5-chloro-3-[(2-ethoxynaphthalen-1-yl)methylidene]-1H-indol-2-one |
| SMILES | CCOc1ccc2ccccc2c1/C=C1/C(=O)Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C21H16ClNO2/c1-2-25-20-10-7-13-5-3-4-6-15(13)17(20)12-18-16-11-14(22)8-9-19(16)23-21(18)24/h3-12H,2H2,1H3,(H,23,24)/b18-12+ |
| InChIKey | ZLZVINBATCHZOV-LDADJPATSA-N |
| XLogP | 5.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.82 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|