C18H16ClNO — CID 112979123
(3E)-5-chloro-3-[(2,4,6-trimethylphenyl)methylidene]-1H-indol-2-one (PubChem CID 112979123) has the molecular formula C18H16ClNO and a molecular weight of 297.79 g/mol. Its IUPAC name is (3E)-5-chloro-3-[(2,4,6-trimethylphenyl)methylidene]-1H-indol-2-one.
| Compound Name | (3E)-5-chloro-3-[(2,4,6-trimethylphenyl)methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 112979123 |
| Molecular Formula | C18H16ClNO |
| Molecular Weight | 297.79 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | (3E)-5-chloro-3-[(2,4,6-trimethylphenyl)methylidene]-1H-indol-2-one |
| SMILES | Cc1cc(C)c(/C=C2/C(=O)Nc3ccc(Cl)cc32)c(C)c1 |
| InChI | InChI=1S/C18H16ClNO/c1-10-6-11(2)14(12(3)7-10)9-16-15-8-13(19)4-5-17(15)20-18(16)21/h4-9H,1-3H3,(H,20,21)/b16-9+ |
| InChIKey | AFMOBHJGOWLJNP-CXUHLZMHSA-N |
| XLogP | 4.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.79 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|