C17H15ClN2O3 — CID 67281073
ethyl 5-[(5-chloro-2-oxo-1H-indol-3-ylidene)methyl]-4-methyl-1H-pyrrole-2-carboxylate (PubChem CID 67281073) has the molecular formula C17H15ClN2O3 and a molecular weight of 330.77 g/mol. Its IUPAC name is ethyl 5-[(5-chloro-2-oxo-1H-indol-3-ylidene)methyl]-4-methyl-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 5-[(5-chloro-2-oxo-1H-indol-3-ylidene)methyl]-4-methyl-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 67281073 |
| Molecular Formula | C17H15ClN2O3 |
| Molecular Weight | 330.77 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | ethyl 5-[(5-chloro-2-oxo-1H-indol-3-ylidene)methyl]-4-methyl-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1cc(C)c(C=C2C(=O)Nc3ccc(Cl)cc32)[nH]1 |
| InChI | InChI=1S/C17H15ClN2O3/c1-3-23-17(22)15-6-9(2)14(19-15)8-12-11-7-10(18)4-5-13(11)20-16(12)21/h4-8,19H,3H2,1-2H3,(H,20,21) |
| InChIKey | DEUASQJEJVBSPW-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.77 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|