C17H17ClN2O3 — CID 158735663
(3Z)-5-chloro-3-[[3-(2-hydroxyethyl)-4-methyl-1H-pyrrol-2-yl]methylidene]-1H-indol-2-one;formaldehyde (PubChem CID 158735663) has the molecular formula C17H17ClN2O3 and a molecular weight of 332.79 g/mol. Its IUPAC name is (3Z)-5-chloro-3-[[3-(2-hydroxyethyl)-4-methyl-1H-pyrrol-2-yl]methylidene]-1H-indol-2-one;formaldehyde.
| Compound Name | (3Z)-5-chloro-3-[[3-(2-hydroxyethyl)-4-methyl-1H-pyrrol-2-yl]methylidene]-1H-indol-2-one;formaldehyde |
|---|---|
| PubChem CID | 158735663 |
| Molecular Formula | C17H17ClN2O3 |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | (3Z)-5-chloro-3-[[3-(2-hydroxyethyl)-4-methyl-1H-pyrrol-2-yl]methylidene]-1H-indol-2-one;formaldehyde |
| SMILES | C=O.Cc1c[nH]c(/C=C2\C(=O)Nc3ccc(Cl)cc32)c1CCO |
| InChI | InChI=1S/C16H15ClN2O2.CH2O/c1-9-8-18-15(11(9)4-5-20)7-13-12-6-10(17)2-3-14(12)19-16(13)21;1-2/h2-3,6-8,18,20H,4-5H2,1H3,(H,19,21);1H2/b13-7-; |
| InChIKey | ILQMRECLQVPKSQ-QCCGTXRUSA-N |
| XLogP | 2.82 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|