C18H17ClN2O5S — CID 73096116
3-[2-[(5-chloro-2-oxo-1H-indol-3-ylidene)methyl]-5-methyl-4-methylsulfonyl-1H-pyrrol-3-yl]propanoic acid (PubChem CID 73096116) has the molecular formula C18H17ClN2O5S and a molecular weight of 408.86 g/mol. Its IUPAC name is 3-[2-[(5-chloro-2-oxo-1H-indol-3-ylidene)methyl]-5-methyl-4-methylsulfonyl-1H-pyrrol-3-yl]propanoic acid.
| Compound Name | 3-[2-[(5-chloro-2-oxo-1H-indol-3-ylidene)methyl]-5-methyl-4-methylsulfonyl-1H-pyrrol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 73096116 |
| Molecular Formula | C18H17ClN2O5S |
| Molecular Weight | 408.86 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | 3-[2-[(5-chloro-2-oxo-1H-indol-3-ylidene)methyl]-5-methyl-4-methylsulfonyl-1H-pyrrol-3-yl]propanoic acid |
| SMILES | Cc1[nH]c(C=C2C(=O)Nc3ccc(Cl)cc32)c(CCC(=O)O)c1S(C)(=O)=O |
| InChI | InChI=1S/C18H17ClN2O5S/c1-9-17(27(2,25)26)11(4-6-16(22)23)15(20-9)8-13-12-7-10(19)3-5-14(12)21-18(13)24/h3,5,7-8,20H,4,6H2,1-2H3,(H,21,24)(H,22,23) |
| InChIKey | YNPVPRJOXYJDCD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.86 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|