C23H18BrClN2O5S — CID 11455625
3-[2-[(Z)-(5-bromo-2-oxo-1H-indol-3-ylidene)methyl]-4-(4-chlorophenyl)sulfonyl-5-methyl-1H-pyrrol-3-yl]propanoic acid (PubChem CID 11455625) has the molecular formula C23H18BrClN2O5S and a molecular weight of 549.83 g/mol. Its IUPAC name is 3-[2-[(Z)-(5-bromo-2-oxo-1H-indol-3-ylidene)methyl]-4-(4-chlorophenyl)sulfonyl-5-methyl-1H-pyrrol-3-yl]propanoic acid.
| Compound Name | 3-[2-[(Z)-(5-bromo-2-oxo-1H-indol-3-ylidene)methyl]-4-(4-chlorophenyl)sulfonyl-5-methyl-1H-pyrrol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 11455625 |
| Molecular Formula | C23H18BrClN2O5S |
| Molecular Weight | 549.83 g/mol |
| Exact Mass | 547.98 |
| IUPAC Name | 3-[2-[(Z)-(5-bromo-2-oxo-1H-indol-3-ylidene)methyl]-4-(4-chlorophenyl)sulfonyl-5-methyl-1H-pyrrol-3-yl]propanoic acid |
| SMILES | Cc1[nH]c(/C=C2\C(=O)Nc3ccc(Br)cc32)c(CCC(=O)O)c1S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H18BrClN2O5S/c1-12-22(33(31,32)15-5-3-14(25)4-6-15)16(7-9-21(28)29)20(26-12)11-18-17-10-13(24)2-8-19(17)27-23(18)30/h2-6,8,10-11,26H,7,9H2,1H3,(H,27,30)(H,28,29)/b18-11- |
| InChIKey | ULDGIUBUGJLXQU-WQRHYEAKSA-N |
| XLogP | 5.08 |
| TPSA | 116.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.83 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|