C27H22Cl2N2O6S — CID 68791156
3-[2-[[5-[(2,6-dichlorophenyl)methylsulfonyl]-2-oxo-1H-indol-3-ylidene]methyl]-4-oxo-1,5,6,7-tetrahydroindol-3-yl]propanoic acid (PubChem CID 68791156) has the molecular formula C27H22Cl2N2O6S and a molecular weight of 573.45 g/mol. Its IUPAC name is 3-[2-[[5-[(2,6-dichlorophenyl)methylsulfonyl]-2-oxo-1H-indol-3-ylidene]methyl]-4-oxo-1,5,6,7-tetrahydroindol-3-yl]propanoic acid.
| Compound Name | 3-[2-[[5-[(2,6-dichlorophenyl)methylsulfonyl]-2-oxo-1H-indol-3-ylidene]methyl]-4-oxo-1,5,6,7-tetrahydroindol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 68791156 |
| Molecular Formula | C27H22Cl2N2O6S |
| Molecular Weight | 573.45 g/mol |
| Exact Mass | 572.06 |
| IUPAC Name | 3-[2-[[5-[(2,6-dichlorophenyl)methylsulfonyl]-2-oxo-1H-indol-3-ylidene]methyl]-4-oxo-1,5,6,7-tetrahydroindol-3-yl]propanoic acid |
| SMILES | O=C(O)CCc1c(C=C2C(=O)Nc3ccc(S(=O)(=O)Cc4c(Cl)cccc4Cl)cc32)[nH]c2c1C(=O)CCC2 |
| InChI | InChI=1S/C27H22Cl2N2O6S/c28-19-3-1-4-20(29)18(19)13-38(36,37)14-7-9-21-16(11-14)17(27(35)31-21)12-23-15(8-10-25(33)34)26-22(30-23)5-2-6-24(26)32/h1,3-4,7,9,11-12,30H,2,5-6,8,10,13H2,(H,31,35)(H,33,34) |
| InChIKey | JAGDKBGQYMRJHR-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 133.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.45 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|