C31H29Cl2N3O5S — CID 68791012
5-[(2,6-dichlorophenyl)methylsulfonyl]-3-[[4-oxo-3-(3-oxo-3-pyrrolidin-1-ylpropyl)-1,5,6,7-tetrahydroindol-2-yl]methylidene]-1H-indol-2-one (PubChem CID 68791012) has the molecular formula C31H29Cl2N3O5S and a molecular weight of 626.56 g/mol. Its IUPAC name is 5-[(2,6-dichlorophenyl)methylsulfonyl]-3-[[4-oxo-3-(3-oxo-3-pyrrolidin-1-ylpropyl)-1,5,6,7-tetrahydroindol-2-yl]methylidene]-1H-indol-2-one.
| Compound Name | 5-[(2,6-dichlorophenyl)methylsulfonyl]-3-[[4-oxo-3-(3-oxo-3-pyrrolidin-1-ylpropyl)-1,5,6,7-tetrahydroindol-2-yl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 68791012 |
| Molecular Formula | C31H29Cl2N3O5S |
| Molecular Weight | 626.56 g/mol |
| Exact Mass | 625.12 |
| IUPAC Name | 5-[(2,6-dichlorophenyl)methylsulfonyl]-3-[[4-oxo-3-(3-oxo-3-pyrrolidin-1-ylpropyl)-1,5,6,7-tetrahydroindol-2-yl]methylidene]-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(S(=O)(=O)Cc3c(Cl)cccc3Cl)cc2C1=Cc1[nH]c2c(c1CCC(=O)N1CCCC1)C(=O)CCC2 |
| InChI | InChI=1S/C31H29Cl2N3O5S/c32-23-5-3-6-24(33)22(23)17-42(40,41)18-9-11-25-20(15-18)21(31(39)35-25)16-27-19(10-12-29(38)36-13-1-2-14-36)30-26(34-27)7-4-8-28(30)37/h3,5-6,9,11,15-16,34H,1-2,4,7-8,10,12-14,17H2,(H,35,39) |
| InChIKey | VZJWCJXWGPBJTH-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 116.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.56 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|