C28H28Cl2N2O4S — CID 72651797
5-[(2,6-dichlorophenyl)methylsulfonyl]-3-[[3-(3-hydroxypropyl)-1,4,5,6,7,8-hexahydrocyclohepta[b]pyrrol-2-yl]methylidene]-1H-indol-2-one (PubChem CID 72651797) has the molecular formula C28H28Cl2N2O4S and a molecular weight of 559.52 g/mol. Its IUPAC name is 5-[(2,6-dichlorophenyl)methylsulfonyl]-3-[[3-(3-hydroxypropyl)-1,4,5,6,7,8-hexahydrocyclohepta[b]pyrrol-2-yl]methylidene]-1H-indol-2-one.
| Compound Name | 5-[(2,6-dichlorophenyl)methylsulfonyl]-3-[[3-(3-hydroxypropyl)-1,4,5,6,7,8-hexahydrocyclohepta[b]pyrrol-2-yl]methylidene]-1H-indol-2-one |
|---|---|
| PubChem CID | 72651797 |
| Molecular Formula | C28H28Cl2N2O4S |
| Molecular Weight | 559.52 g/mol |
| Exact Mass | 558.11 |
| IUPAC Name | 5-[(2,6-dichlorophenyl)methylsulfonyl]-3-[[3-(3-hydroxypropyl)-1,4,5,6,7,8-hexahydrocyclohepta[b]pyrrol-2-yl]methylidene]-1H-indol-2-one |
| SMILES | O=C1Nc2ccc(S(=O)(=O)Cc3c(Cl)cccc3Cl)cc2C1=Cc1[nH]c2c(c1CCCO)CCCCC2 |
| InChI | InChI=1S/C28H28Cl2N2O4S/c29-23-8-4-9-24(30)22(23)16-37(35,36)17-11-12-26-20(14-17)21(28(34)32-26)15-27-19(7-5-13-33)18-6-2-1-3-10-25(18)31-27/h4,8-9,11-12,14-15,31,33H,1-3,5-7,10,13,16H2,(H,32,34) |
| InChIKey | RBYBEWUPYAIWAR-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.52 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|