C33H36Cl2N4O5S — CID 68789497
3-[2-[[5-[(2,6-dichlorophenyl)methylsulfonyl]-2-oxo-1H-indol-3-ylidene]methyl]-4-oxo-1,5,6,7-tetrahydroindol-3-yl]-N-[2-(diethylamino)ethyl]propanamide (PubChem CID 68789497) has the molecular formula C33H36Cl2N4O5S and a molecular weight of 671.65 g/mol. Its IUPAC name is 3-[2-[[5-[(2,6-dichlorophenyl)methylsulfonyl]-2-oxo-1H-indol-3-ylidene]methyl]-4-oxo-1,5,6,7-tetrahydroindol-3-yl]-N-[2-(diethylamino)ethyl]propanamide.
| Compound Name | 3-[2-[[5-[(2,6-dichlorophenyl)methylsulfonyl]-2-oxo-1H-indol-3-ylidene]methyl]-4-oxo-1,5,6,7-tetrahydroindol-3-yl]-N-[2-(diethylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 68789497 |
| Molecular Formula | C33H36Cl2N4O5S |
| Molecular Weight | 671.65 g/mol |
| Exact Mass | 670.18 |
| IUPAC Name | 3-[2-[[5-[(2,6-dichlorophenyl)methylsulfonyl]-2-oxo-1H-indol-3-ylidene]methyl]-4-oxo-1,5,6,7-tetrahydroindol-3-yl]-N-[2-(diethylamino)ethyl]propanamide |
| SMILES | CCN(CC)CCNC(=O)CCc1c(C=C2C(=O)Nc3ccc(S(=O)(=O)Cc4c(Cl)cccc4Cl)cc32)[nH]c2c1C(=O)CCC2 |
| InChI | InChI=1S/C33H36Cl2N4O5S/c1-3-39(4-2)16-15-36-31(41)14-12-21-29(37-28-9-6-10-30(40)32(21)28)18-23-22-17-20(11-13-27(22)38-33(23)42)45(43,44)19-24-25(34)7-5-8-26(24)35/h5,7-8,11,13,17-18,37H,3-4,6,9-10,12,14-16,19H2,1-2H3,(H,36,41)(H,38,42) |
| InChIKey | DKSIRQBNQJRFSB-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 128.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.65 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|