C34H39N5O5S — CID 68789646
N-[2-(diethylamino)ethyl]-3-[2-[[5-(2,3-dihydroindol-1-ylsulfonyl)-2-oxo-1H-indol-3-ylidene]methyl]-4-oxo-1,5,6,7-tetrahydroindol-3-yl]propanamide (PubChem CID 68789646) has the molecular formula C34H39N5O5S and a molecular weight of 629.78 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-3-[2-[[5-(2,3-dihydroindol-1-ylsulfonyl)-2-oxo-1H-indol-3-ylidene]methyl]-4-oxo-1,5,6,7-tetrahydroindol-3-yl]propanamide.
| Compound Name | N-[2-(diethylamino)ethyl]-3-[2-[[5-(2,3-dihydroindol-1-ylsulfonyl)-2-oxo-1H-indol-3-ylidene]methyl]-4-oxo-1,5,6,7-tetrahydroindol-3-yl]propanamide |
|---|---|
| PubChem CID | 68789646 |
| Molecular Formula | C34H39N5O5S |
| Molecular Weight | 629.78 g/mol |
| Exact Mass | 629.27 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-3-[2-[[5-(2,3-dihydroindol-1-ylsulfonyl)-2-oxo-1H-indol-3-ylidene]methyl]-4-oxo-1,5,6,7-tetrahydroindol-3-yl]propanamide |
| SMILES | CCN(CC)CCNC(=O)CCc1c(C=C2C(=O)Nc3ccc(S(=O)(=O)N4CCc5ccccc54)cc32)[nH]c2c1C(=O)CCC2 |
| InChI | InChI=1S/C34H39N5O5S/c1-3-38(4-2)19-17-35-32(41)15-13-24-29(36-28-9-7-11-31(40)33(24)28)21-26-25-20-23(12-14-27(25)37-34(26)42)45(43,44)39-18-16-22-8-5-6-10-30(22)39/h5-6,8,10,12,14,20-21,36H,3-4,7,9,11,13,15-19H2,1-2H3,(H,35,41)(H,37,42) |
| InChIKey | HTEJVNIXRHMQEE-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 131.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.78 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|