C34H42N4O3S — CID 58779641
(3Z)-3-[[3-[3-(diethylamino)propyl]-6,6-dimethyl-1,4,5,7-tetrahydroindol-2-yl]methylidene]-5-(2,3-dihydroindol-1-ylsulfonyl)-1H-indol-2-one (PubChem CID 58779641) has the molecular formula C34H42N4O3S and a molecular weight of 586.80 g/mol. Its IUPAC name is (3Z)-3-[[3-[3-(diethylamino)propyl]-6,6-dimethyl-1,4,5,7-tetrahydroindol-2-yl]methylidene]-5-(2,3-dihydroindol-1-ylsulfonyl)-1H-indol-2-one.
| Compound Name | (3Z)-3-[[3-[3-(diethylamino)propyl]-6,6-dimethyl-1,4,5,7-tetrahydroindol-2-yl]methylidene]-5-(2,3-dihydroindol-1-ylsulfonyl)-1H-indol-2-one |
|---|---|
| PubChem CID | 58779641 |
| Molecular Formula | C34H42N4O3S |
| Molecular Weight | 586.80 g/mol |
| Exact Mass | 586.30 |
| IUPAC Name | (3Z)-3-[[3-[3-(diethylamino)propyl]-6,6-dimethyl-1,4,5,7-tetrahydroindol-2-yl]methylidene]-5-(2,3-dihydroindol-1-ylsulfonyl)-1H-indol-2-one |
| SMILES | CCN(CC)CCCc1c(/C=C2\C(=O)Nc3ccc(S(=O)(=O)N4CCc5ccccc54)cc32)[nH]c2c1CCC(C)(C)C2 |
| InChI | InChI=1S/C34H42N4O3S/c1-5-37(6-2)18-9-11-25-26-15-17-34(3,4)22-31(26)35-30(25)21-28-27-20-24(13-14-29(27)36-33(28)39)42(40,41)38-19-16-23-10-7-8-12-32(23)38/h7-8,10,12-14,20-21,35H,5-6,9,11,15-19,22H2,1-4H3,(H,36,39)/b28-21- |
| InChIKey | CTDLFEZOHFUVFM-HFTWOUSFSA-N |
| XLogP | 6.05 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.80 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|