C33H34N4O5S2 — CID 17139329
1,3-bis[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]-1,3-diethylurea (PubChem CID 17139329) has the molecular formula C33H34N4O5S2 and a molecular weight of 630.79 g/mol. Its IUPAC name is 1,3-bis[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]-1,3-diethylurea.
| Compound Name | 1,3-bis[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]-1,3-diethylurea |
|---|---|
| PubChem CID | 17139329 |
| Molecular Formula | C33H34N4O5S2 |
| Molecular Weight | 630.79 g/mol |
| Exact Mass | 630.20 |
| IUPAC Name | 1,3-bis[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]-1,3-diethylurea |
| SMILES | CCN(C(=O)N(CC)c1ccc(S(=O)(=O)N2CCc3ccccc32)cc1)c1ccc(S(=O)(=O)N2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C33H34N4O5S2/c1-3-34(27-13-17-29(18-14-27)43(39,40)36-23-21-25-9-5-7-11-31(25)36)33(38)35(4-2)28-15-19-30(20-16-28)44(41,42)37-24-22-26-10-6-8-12-32(26)37/h5-20H,3-4,21-24H2,1-2H3 |
| InChIKey | GRMHNHUYXCHIAL-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 98.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.79 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |