C20H24N2O4S — CID 33237289
5-(2,3-dihydroindol-1-ylsulfonyl)-N,N-diethyl-2-methoxybenzamide (PubChem CID 33237289) has the molecular formula C20H24N2O4S and a molecular weight of 388.49 g/mol. Its IUPAC name is 5-(2,3-dihydroindol-1-ylsulfonyl)-N,N-diethyl-2-methoxybenzamide.
| Compound Name | 5-(2,3-dihydroindol-1-ylsulfonyl)-N,N-diethyl-2-methoxybenzamide |
|---|---|
| PubChem CID | 33237289 |
| Molecular Formula | C20H24N2O4S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 5-(2,3-dihydroindol-1-ylsulfonyl)-N,N-diethyl-2-methoxybenzamide |
| SMILES | CCN(CC)C(=O)c1cc(S(=O)(=O)N2CCc3ccccc32)ccc1OC |
| InChI | InChI=1S/C20H24N2O4S/c1-4-21(5-2)20(23)17-14-16(10-11-19(17)26-3)27(24,25)22-13-12-15-8-6-7-9-18(15)22/h6-11,14H,4-5,12-13H2,1-3H3 |
| InChIKey | XQXSXRMKMGFWNF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |