C24H26N2O6S — CID 16535116
[2-[bis(prop-2-enyl)amino]-2-oxoethyl] 5-(2,3-dihydroindol-1-ylsulfonyl)-2-methoxybenzoate (PubChem CID 16535116) has the molecular formula C24H26N2O6S and a molecular weight of 470.55 g/mol. Its IUPAC name is [2-[bis(prop-2-enyl)amino]-2-oxoethyl] 5-(2,3-dihydroindol-1-ylsulfonyl)-2-methoxybenzoate.
| Compound Name | [2-[bis(prop-2-enyl)amino]-2-oxoethyl] 5-(2,3-dihydroindol-1-ylsulfonyl)-2-methoxybenzoate |
|---|---|
| PubChem CID | 16535116 |
| Molecular Formula | C24H26N2O6S |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | [2-[bis(prop-2-enyl)amino]-2-oxoethyl] 5-(2,3-dihydroindol-1-ylsulfonyl)-2-methoxybenzoate |
| SMILES | C=CCN(CC=C)C(=O)COC(=O)c1cc(S(=O)(=O)N2CCc3ccccc32)ccc1OC |
| InChI | InChI=1S/C24H26N2O6S/c1-4-13-25(14-5-2)23(27)17-32-24(28)20-16-19(10-11-22(20)31-3)33(29,30)26-15-12-18-8-6-7-9-21(18)26/h4-11,16H,1-2,12-15,17H2,3H3 |
| InChIKey | STJHELXFZCOGIG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|