C26H25NO6S — CID 42965543
(4-oxo-4-phenylbutyl) 5-(2,3-dihydroindol-1-ylsulfonyl)-2-methoxybenzoate (PubChem CID 42965543) has the molecular formula C26H25NO6S and a molecular weight of 479.55 g/mol. Its IUPAC name is (4-oxo-4-phenylbutyl) 5-(2,3-dihydroindol-1-ylsulfonyl)-2-methoxybenzoate.
| Compound Name | (4-oxo-4-phenylbutyl) 5-(2,3-dihydroindol-1-ylsulfonyl)-2-methoxybenzoate |
|---|---|
| PubChem CID | 42965543 |
| Molecular Formula | C26H25NO6S |
| Molecular Weight | 479.55 g/mol |
| Exact Mass | 479.14 |
| IUPAC Name | (4-oxo-4-phenylbutyl) 5-(2,3-dihydroindol-1-ylsulfonyl)-2-methoxybenzoate |
| SMILES | COc1ccc(S(=O)(=O)N2CCc3ccccc32)cc1C(=O)OCCCC(=O)c1ccccc1 |
| InChI | InChI=1S/C26H25NO6S/c1-32-25-14-13-21(34(30,31)27-16-15-19-8-5-6-11-23(19)27)18-22(25)26(29)33-17-7-12-24(28)20-9-3-2-4-10-20/h2-6,8-11,13-14,18H,7,12,15-17H2,1H3 |
| InChIKey | IBSPGPXPCQQQFS-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|