C21H19N3O3S — CID 1150802
1-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]-3-phenylurea (PubChem CID 1150802) has the molecular formula C21H19N3O3S and a molecular weight of 393.47 g/mol. Its IUPAC name is 1-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]-3-phenylurea.
| Compound Name | 1-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]-3-phenylurea |
|---|---|
| PubChem CID | 1150802 |
| Molecular Formula | C21H19N3O3S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 1-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]-3-phenylurea |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(S(=O)(=O)N2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C21H19N3O3S/c25-21(22-17-7-2-1-3-8-17)23-18-10-12-19(13-11-18)28(26,27)24-15-14-16-6-4-5-9-20(16)24/h1-13H,14-15H2,(H2,22,23,25) |
| InChIKey | YLBBFFGAQVOFNT-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |