C20H22N2O5S — CID 27522470
(3R)-5-[4-(2,3-dihydroindol-1-ylsulfonyl)anilino]-3-methyl-5-oxopentanoic acid (PubChem CID 27522470) has the molecular formula C20H22N2O5S and a molecular weight of 402.47 g/mol. Its IUPAC name is (3R)-5-[4-(2,3-dihydroindol-1-ylsulfonyl)anilino]-3-methyl-5-oxopentanoic acid.
| Compound Name | (3R)-5-[4-(2,3-dihydroindol-1-ylsulfonyl)anilino]-3-methyl-5-oxopentanoic acid |
|---|---|
| PubChem CID | 27522470 |
| Molecular Formula | C20H22N2O5S |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | (3R)-5-[4-(2,3-dihydroindol-1-ylsulfonyl)anilino]-3-methyl-5-oxopentanoic acid |
| SMILES | C[C@@H](CC(=O)O)CC(=O)Nc1ccc(S(=O)(=O)N2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C20H22N2O5S/c1-14(13-20(24)25)12-19(23)21-16-6-8-17(9-7-16)28(26,27)22-11-10-15-4-2-3-5-18(15)22/h2-9,14H,10-13H2,1H3,(H,21,23)(H,24,25)/t14-/m1/s1 |
| InChIKey | RBTGLBVYSJLRQL-CQSZACIVSA-N |
| XLogP | 2.88 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |