C22H20N2O4S — CID 4305979
2-[4-(2,3-dihydroindol-1-ylsulfonyl)phenoxy]-N-phenylacetamide (PubChem CID 4305979) has the molecular formula C22H20N2O4S and a molecular weight of 408.48 g/mol. Its IUPAC name is 2-[4-(2,3-dihydroindol-1-ylsulfonyl)phenoxy]-N-phenylacetamide.
| Compound Name | 2-[4-(2,3-dihydroindol-1-ylsulfonyl)phenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 4305979 |
| Molecular Formula | C22H20N2O4S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.11 |
| IUPAC Name | 2-[4-(2,3-dihydroindol-1-ylsulfonyl)phenoxy]-N-phenylacetamide |
| SMILES | O=C(COc1ccc(S(=O)(=O)N2CCc3ccccc32)cc1)Nc1ccccc1 |
| InChI | InChI=1S/C22H20N2O4S/c25-22(23-18-7-2-1-3-8-18)16-28-19-10-12-20(13-11-19)29(26,27)24-15-14-17-6-4-5-9-21(17)24/h1-13H,14-16H2,(H,23,25) |
| InChIKey | ZKDPERKUQVDWHC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |