C22H18Br2N2O4S — CID 1013039
2-(2,4-dibromophenoxy)-N-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]acetamide (PubChem CID 1013039) has the molecular formula C22H18Br2N2O4S and a molecular weight of 566.27 g/mol. Its IUPAC name is 2-(2,4-dibromophenoxy)-N-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]acetamide.
| Compound Name | 2-(2,4-dibromophenoxy)-N-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]acetamide |
|---|---|
| PubChem CID | 1013039 |
| Molecular Formula | C22H18Br2N2O4S |
| Molecular Weight | 566.27 g/mol |
| Exact Mass | 563.94 |
| IUPAC Name | 2-(2,4-dibromophenoxy)-N-[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]acetamide |
| SMILES | O=C(COc1ccc(Br)cc1Br)Nc1ccc(S(=O)(=O)N2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C22H18Br2N2O4S/c23-16-5-10-21(19(24)13-16)30-14-22(27)25-17-6-8-18(9-7-17)31(28,29)26-12-11-15-3-1-2-4-20(15)26/h1-10,13H,11-12,14H2,(H,25,27) |
| InChIKey | BFCZHHIXRQOTQV-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.27 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |