C23H21IN2O4S — CID 126392373
2-[4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenoxy]-N-(4-iodophenyl)acetamide (PubChem CID 126392373) has the molecular formula C23H21IN2O4S and a molecular weight of 548.40 g/mol. Its IUPAC name is 2-[4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenoxy]-N-(4-iodophenyl)acetamide.
| Compound Name | 2-[4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenoxy]-N-(4-iodophenyl)acetamide |
|---|---|
| PubChem CID | 126392373 |
| Molecular Formula | C23H21IN2O4S |
| Molecular Weight | 548.40 g/mol |
| Exact Mass | 548.03 |
| IUPAC Name | 2-[4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenoxy]-N-(4-iodophenyl)acetamide |
| SMILES | O=C(COc1ccc(S(=O)(=O)N2CCCc3ccccc32)cc1)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C23H21IN2O4S/c24-18-7-9-19(10-8-18)25-23(27)16-30-20-11-13-21(14-12-20)31(28,29)26-15-3-5-17-4-1-2-6-22(17)26/h1-2,4,6-14H,3,5,15-16H2,(H,25,27) |
| InChIKey | BQVURVBSSNWNHN-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.40 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|