C22H19IN2O3S — CID 17320464
N-[4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]-3-iodobenzamide (PubChem CID 17320464) has the molecular formula C22H19IN2O3S and a molecular weight of 518.38 g/mol. Its IUPAC name is N-[4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]-3-iodobenzamide.
| Compound Name | N-[4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]-3-iodobenzamide |
|---|---|
| PubChem CID | 17320464 |
| Molecular Formula | C22H19IN2O3S |
| Molecular Weight | 518.38 g/mol |
| Exact Mass | 518.02 |
| IUPAC Name | N-[4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]-3-iodobenzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)N2CCCc3ccccc32)cc1)c1cccc(I)c1 |
| InChI | InChI=1S/C22H19IN2O3S/c23-18-8-3-6-17(15-18)22(26)24-19-10-12-20(13-11-19)29(27,28)25-14-4-7-16-5-1-2-9-21(16)25/h1-3,5-6,8-13,15H,4,7,14H2,(H,24,26) |
| InChIKey | VIUDQZNEUGNWQP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.38 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|