C22H18Cl2N2O3S — CID 17320187
2,5-dichloro-N-[4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]benzamide (PubChem CID 17320187) has the molecular formula C22H18Cl2N2O3S and a molecular weight of 461.37 g/mol. Its IUPAC name is 2,5-dichloro-N-[4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]benzamide.
| Compound Name | 2,5-dichloro-N-[4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 17320187 |
| Molecular Formula | C22H18Cl2N2O3S |
| Molecular Weight | 461.37 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | 2,5-dichloro-N-[4-(3,4-dihydro-2H-quinolin-1-ylsulfonyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)N2CCCc3ccccc32)cc1)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C22H18Cl2N2O3S/c23-16-7-12-20(24)19(14-16)22(27)25-17-8-10-18(11-9-17)30(28,29)26-13-3-5-15-4-1-2-6-21(15)26/h1-2,4,6-12,14H,3,5,13H2,(H,25,27) |
| InChIKey | LEXVIHUVQFMZMT-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.37 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |