C22H17Cl2N3O3S2 — CID 3521037
2,4-dichloro-N-[[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]carbamothioyl]benzamide (PubChem CID 3521037) has the molecular formula C22H17Cl2N3O3S2 and a molecular weight of 506.44 g/mol. Its IUPAC name is 2,4-dichloro-N-[[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 2,4-dichloro-N-[[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3521037 |
| Molecular Formula | C22H17Cl2N3O3S2 |
| Molecular Weight | 506.44 g/mol |
| Exact Mass | 505.01 |
| IUPAC Name | 2,4-dichloro-N-[[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(S(=O)(=O)N2CCc3ccccc32)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H17Cl2N3O3S2/c23-15-5-10-18(19(24)13-15)21(28)26-22(31)25-16-6-8-17(9-7-16)32(29,30)27-12-11-14-3-1-2-4-20(14)27/h1-10,13H,11-12H2,(H2,25,26,28,31) |
| InChIKey | UOKBIBKUYCDZRD-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.44 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|