C26H27N3O4S2 — CID 4941479
2-butoxy-N-[[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]carbamothioyl]benzamide (PubChem CID 4941479) has the molecular formula C26H27N3O4S2 and a molecular weight of 509.65 g/mol. Its IUPAC name is 2-butoxy-N-[[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 2-butoxy-N-[[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4941479 |
| Molecular Formula | C26H27N3O4S2 |
| Molecular Weight | 509.65 g/mol |
| Exact Mass | 509.14 |
| IUPAC Name | 2-butoxy-N-[[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]carbamothioyl]benzamide |
| SMILES | CCCCOc1ccccc1C(=O)NC(=S)Nc1ccc(S(=O)(=O)N2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C26H27N3O4S2/c1-2-3-18-33-24-11-7-5-9-22(24)25(30)28-26(34)27-20-12-14-21(15-13-20)35(31,32)29-17-16-19-8-4-6-10-23(19)29/h4-15H,2-3,16-18H2,1H3,(H2,27,28,30,34) |
| InChIKey | YPZBVACPRGGWBO-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.65 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|