C26H27N3O5S2 — CID 17122995
N-[[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]carbamothioyl]-2-(2-ethoxyethoxy)benzamide (PubChem CID 17122995) has the molecular formula C26H27N3O5S2 and a molecular weight of 525.65 g/mol. Its IUPAC name is N-[[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]carbamothioyl]-2-(2-ethoxyethoxy)benzamide.
| Compound Name | N-[[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]carbamothioyl]-2-(2-ethoxyethoxy)benzamide |
|---|---|
| PubChem CID | 17122995 |
| Molecular Formula | C26H27N3O5S2 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | N-[[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]carbamothioyl]-2-(2-ethoxyethoxy)benzamide |
| SMILES | CCOCCOc1ccccc1C(=O)NC(=S)Nc1ccc(S(=O)(=O)N2CCc3ccccc32)cc1 |
| InChI | InChI=1S/C26H27N3O5S2/c1-2-33-17-18-34-24-10-6-4-8-22(24)25(30)28-26(35)27-20-11-13-21(14-12-20)36(31,32)29-16-15-19-7-3-5-9-23(19)29/h3-14H,2,15-18H2,1H3,(H2,27,28,30,35) |
| InChIKey | MQTDXIQPEZADEF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|