C22H18FN3O3S2 — CID 4950375
N-[[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]carbamothioyl]-2-fluorobenzamide (PubChem CID 4950375) has the molecular formula C22H18FN3O3S2 and a molecular weight of 455.54 g/mol. Its IUPAC name is N-[[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]carbamothioyl]-2-fluorobenzamide.
| Compound Name | N-[[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]carbamothioyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 4950375 |
| Molecular Formula | C22H18FN3O3S2 |
| Molecular Weight | 455.54 g/mol |
| Exact Mass | 455.08 |
| IUPAC Name | N-[[4-(2,3-dihydroindol-1-ylsulfonyl)phenyl]carbamothioyl]-2-fluorobenzamide |
| SMILES | O=C(NC(=S)Nc1ccc(S(=O)(=O)N2CCc3ccccc32)cc1)c1ccccc1F |
| InChI | InChI=1S/C22H18FN3O3S2/c23-19-7-3-2-6-18(19)21(27)25-22(30)24-16-9-11-17(12-10-16)31(28,29)26-14-13-15-5-1-4-8-20(15)26/h1-12H,13-14H2,(H2,24,25,27,30) |
| InChIKey | SZUBOJNFQGHRMY-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.54 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|